- Mucobromic acid
-
- $1.00 / 1kg
-
2025-12-03
- CAS:488-11-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10 mt
- Mucobromic acid
-
- $0.00 / 1KG
-
2025-06-27
- CAS:488-11-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- Mucobromic Acid
-
- $10.70 / 1kg
-
2025-05-26
- CAS:488-11-9
- Min. Order: 10kg
- Purity: 99%
- Supply Ability: 10000kg
|
| | Mucobromic acid Basic information |
| Product Name: | Mucobromic acid | | Synonyms: | 2-Butenoic acid, 2,3-dibromo-4-oxo-, (Z)-;3-dibromo-4-oxo-(z)-2-butenoicaci;Bromomucic acid;Malealdehydic acid, dibromo-;Mucobromic acid (2,3-dibromo-4-oxo-2-butenoic acid) (open form);(2Z)-2,3-Dibromo-4-oxo-2-butenoic acid;MUCOBROMIC ACID;TIMTEC-BB SBB007543 | | CAS: | 488-11-9 | | MF: | C4H2Br2O3 | | MW: | 257.86 | | EINECS: | 207-670-5 | | Product Categories: | bc0001 | | Mol File: | 488-11-9.mol |  |
| | Mucobromic acid Chemical Properties |
| Melting point | 120-124 °C (lit.) | | Boiling point | 321.8±42.0 °C(Predicted) | | density | 2.2801 (rough estimate) | | refractive index | 1.4947 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | methanol: 0.1 g/mL, clear | | pka | 0.28±0.44(Predicted) | | form | Crystalline Powder | | color | White to beige | | BRN | 1705707 | | InChI | InChI=1S/C4H2Br2O3/c5-2(1-7)3(6)4(8)9/h1H,(H,8,9)/b3-2- | | InChIKey | NCNYEGJDGNOYJX-IHWYPQMZSA-N | | SMILES | C(O)(=O)/C(/Br)=C(/Br)\C=O | | CAS DataBase Reference | 488-11-9(CAS DataBase Reference) | | NIST Chemistry Reference | Mucobromic acid(488-11-9) | | EPA Substance Registry System | 2-Butenoic acid, 2,3-dibromo-4-oxo-, (2Z)- (488-11-9) |
| Hazard Codes | C,Xi | | Risk Statements | 34-37 | | Safety Statements | 26-36/37/39-45-27 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | TSCA | Yes | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29183000 |
| | Mucobromic acid Usage And Synthesis |
| Chemical Properties | White to beige crystalline powder | | Uses | Mucobromic Acid is an inhibitor of tumoral and pancreatic L-asparagine synthetases. |
| | Mucobromic acid Preparation Products And Raw materials |
|