- Tri-propylphosphine
-
- $1.00 / 1KG
-
2020-03-16
- CAS:2234-97-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 tons
- TRIPROPYLPHOSPHINE
-
- $3.00 / 3KG
-
2019-07-12
- CAS:2234-97-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | TRIPROPYLPHOSPHINE Basic information |
| | TRIPROPYLPHOSPHINE Chemical Properties |
| Boiling point | 72-74 °C12 mm Hg(lit.) | | density | 0.801 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4584(lit.) | | Fp | 144 °F | | storage temp. | Flammables area | | form | liquid | | Specific Gravity | 0.807 | | color | colorless | | Water Solubility | Insoluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C9H21P/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3 | | InChIKey | KCTAHLRCZMOTKM-UHFFFAOYSA-N | | SMILES | P(CCC)(CCC)CCC | | CAS DataBase Reference | 2234-97-1(CAS DataBase Reference) |
| | TRIPROPYLPHOSPHINE Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | suzuki reaction |
| | TRIPROPYLPHOSPHINE Preparation Products And Raw materials |
|