|
|
| | Sodium dimethyl 5-sulphonatoisophthalate Basic information |
| | Sodium dimethyl 5-sulphonatoisophthalate Chemical Properties |
| Melting point | >300 °C(lit.) | | density | 1.705[at 20℃] | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in water | | form | powder to crystal | | color | White to Almost white | | Water Solubility | 31g/L at 20℃ | | InChI | InChI=1S/C10H10O7S.Na.H/c1-16-9(11)6-3-7(10(12)17-2)5-8(4-6)18(13,14)15;;/h3-5H,1-2H3,(H,13,14,15);; | | InChIKey | NKSXFLJIAWNZSP-UHFFFAOYSA-N | | SMILES | S(C1C=C(C(=O)OC)C=C(C(=O)OC)C=1)(O)(=O)=O.[NaH] | | LogP | -2.86 at 20℃ | | CAS DataBase Reference | 3965-55-7(CAS DataBase Reference) | | EPA Substance Registry System | Sodium 1,3-dimethyl 5-sulfoisophthalate (3965-55-7) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | DB5044550 | | TSCA | TSCA listed | | HS Code | 29173990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Sodium dimethyl 5-sulphonatoisophthalate Usage And Synthesis |
| Chemical Properties | white amorphous powder | | Uses | - Enhancing poly(lactic acid) crystallization: Dimethyl 5-sulfoisophthalate sodium salt was used as a nucleating agent in poly(lactic acid), significantly improving its crystallization behavior, which is crucial for developing biodegradable plastics with enhanced mechanical properties (Jongpanya-Ngam et al., 2022).
- Development of biodegradable polyester ionomers: A study on biodegradable aliphatic polyester ionomers, potentially incorporating Dimethyl 5-sulfoisophthalate sodium salt, focused on synthesizing environmentally friendly materials that offer practical benefits in medical and packaging applications (Han et al., 2004).
| | General Description | Dimethyl 5-sulfoisophthalate sodium salt was used to produce a series of water-soluble polymeric surfactants. | | Flammability and Explosibility | Non flammable |
| | Sodium dimethyl 5-sulphonatoisophthalate Preparation Products And Raw materials |
|