|
|
| | 3-Benzyloxybenzeneboronic acid Basic information |
| | 3-Benzyloxybenzeneboronic acid Chemical Properties |
| Melting point | 125-130 °C (lit.) | | Boiling point | 428.2±47.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Water Solubility | Slightly soluble in water | | form | Crystalline Powder or Crystals | | pka | 8.10±0.10(Predicted) | | color | White to beige | | BRN | 6808244 | | InChI | 1S/C13H13BO3/c15-14(16)12-7-4-8-13(9-12)17-10-11-5-2-1-3-6-11/h1-9,15-16H,10H2 | | InChIKey | WIJNYNBSPQMJGO-UHFFFAOYSA-N | | SMILES | OB(O)c1cccc(OCc2ccccc2)c1 | | CAS DataBase Reference | 156682-54-1(CAS DataBase Reference) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-36-26/37 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | IRRITANT | | HS Code | 29310095 | | Storage Class | 11 - Combustible Solids |
| | 3-Benzyloxybenzeneboronic acid Usage And Synthesis |
| Chemical Properties | white crystalline powde | | Uses | Reactant for:
- Microwave Suzuki-Miyaura coupling
- Preparation of palladium-based fluoride-derived electrophilic fluorination reagent for PET imaging agents
- Synthesis of substituted isoindolines via palladium-catalyzed cascade reaction
- Ruthenium-catalyzed hydrogenation
- Suzuki coupling reactions
| | Uses | suzuki reaction | | Uses | Reactant for:• ;Microwave Suzuki-Miyaura coupling1• ;Preparation of palladium-based fluoride-derived electrophilic fluorination reagent for PET imaging agents2• ;Synthesis of substituted isoindolines via palladium-catalyzed cascade reaction3• ;Ruthenium-catalyzed hydrogenation4• ;Suzuki coupling reactions5 | | General Description | Contains varying amounts of anhydride. |
| | 3-Benzyloxybenzeneboronic acid Preparation Products And Raw materials |
|