|
|
| | 1,12-DODECANEDIOL DIMETHACRYLATE Basic information |
| Product Name: | 1,12-DODECANEDIOL DIMETHACRYLATE | | Synonyms: | 2-Propenoicacid,2-methyl-,1,12-dodecanediylester;Dodecamethylene-dimethylacrylate;1,12-dodecanediyl bismethacrylate;1,12-Dodecandiylbismethacrylat;1,12-DODECANEDIOL DIMETHACRYLATE;Bis(2-methylpropenoic acid)1,12-dodecanediyl ester;Dimethacrylic acid 1,12-dodecanediyl ester;Dodecanodiodimethacrylate | | CAS: | 72829-09-5 | | MF: | C20H34O4 | | MW: | 338.48 | | EINECS: | 276-900-4 | | Product Categories: | monomer | | Mol File: | 72829-09-5.mol |  |
| | 1,12-DODECANEDIOL DIMETHACRYLATE Chemical Properties |
| Boiling point | >250°C | | density | 0,95 g/cm3 | | vapor pressure | 0.002Pa at 25℃ | | refractive index | 1.4590 to 1.4630 | | Fp | 130°C | | solubility | soluble in Methanol | | form | clear liquid | | color | Colorless to Light yellow | | Water Solubility | 11.1μg/L at 20℃ | | InChI | InChI=1S/C20H34O4/c1-17(2)19(21)23-15-13-11-9-7-5-6-8-10-12-14-16-24-20(22)18(3)4/h1,3,5-16H2,2,4H3 | | InChIKey | HYQASEVIBPSPMK-UHFFFAOYSA-N | | SMILES | C(OC(=O)C(C)=C)CCCCCCCCCCCOC(=O)C(C)=C | | LogP | 6.5 at 40℃ | | EPA Substance Registry System | 1,12-Dodecanediol dimethacrylate (72829-09-5) |
| | 1,12-DODECANEDIOL DIMETHACRYLATE Usage And Synthesis |
| Uses | 1,12-Dodecyl Dimethacrylate is a used to produce polymerizable dental material that can be used create material for crowns and bridges and as core buildup material. |
| | 1,12-DODECANEDIOL DIMETHACRYLATE Preparation Products And Raw materials |
|