- SCYLLO-INOSITOL
-
- $1.00 / 1KG
-
2023-09-11
- CAS:488-59-5
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
|
| | SCYLLO-INOSITOL Basic information |
| Product Name: | SCYLLO-INOSITOL | | Synonyms: | COCOSITOL;Inositol, scyllo-;QUERCINITOL;SCYLLITO;SCYLLITOL;SCYLLO-INOSITOL;Scyllitol, Cocositol, Quercinitol,1,3,5/2,4,6-Hexahydroxycyclohexane;1,3,5/2,4,6-HEXAHYDROXYCYCLOHEXANE | | CAS: | 488-59-5 | | MF: | C6H12O6 | | MW: | 180.16 | | EINECS: | 200-258-5 | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals;All Inositols;Biochemistry;Sugars;Vitamin Related Compounds;Vitamins;Inositols | | Mol File: | 488-59-5.mol |  |
| | SCYLLO-INOSITOL Chemical Properties |
| Melting point | 350 °C | | Boiling point | 291.3±40.0 °C(Predicted) | | density | 2.038±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 0 ° (C=1, H2O) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 12.63±0.70(Predicted) | | color | White to Off-White | | Water Solubility | 10.1g/L(18 ºC) | | InChI | InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3+,4+,5-,6- | | InChIKey | CDAISMWEOUEBRE-CDRYSYESSA-N | | SMILES | O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O | | CAS DataBase Reference | 488-59-5(CAS DataBase Reference) | | EPA Substance Registry System | scyllo-Inositol (488-59-5) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29061990 |
| | SCYLLO-INOSITOL Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | scyllo-Inositol, acyclohexanehexol derivative used in the treatment of amyotrophic lateral sclerosis. Anti-Alzheimer''s agent. | | Definition | ChEBI: Any cyclohexane-1,2,3,4,5,6-hexol. |
| | SCYLLO-INOSITOL Preparation Products And Raw materials |
|