- 3-Cyanobenzyl Chloride
-
- $0.00 / 1KG
-
2025-12-13
- CAS:64407-07-4
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
- M-CYANOBENZYL CHLORIDE
-
- $0.00 / 1kg
-
2025-12-13
- CAS:64407-07-4
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: Customise
- M-CYANOBENZYL CHLORIDE
-
- $10.00 / 1KG
-
2025-12-11
- CAS:64407-07-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
|
| | M-CYANOBENZYL CHLORIDE Basic information |
| Product Name: | M-CYANOBENZYL CHLORIDE | | Synonyms: | Benzonitrile, 3-(chloromethyl)-;3-CHLOROMETHYLBENZONITRILE;3-CYANO BENZYL CHLORIDE;M-CYANOBENZYL CHLORIDE;3-(Chloromethyl)Tolunitrile;Zinc02583900;[(3-cyanophenyl)Methyl]chloranuide;Benzonitrile, 3-(chloromethyl)- (9CI) | | CAS: | 64407-07-4 | | MF: | C8H6ClN | | MW: | 151.59 | | EINECS: | | | Product Categories: | HALOMETYL | | Mol File: | 64407-07-4.mol |  |
| | M-CYANOBENZYL CHLORIDE Chemical Properties |
| Melting point | 67.0 to 71.0 °C | | Boiling point | 260°C(lit.) | | density | 1.1976 (rough estimate) | | refractive index | 1.5660 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C8H6ClN/c9-5-7-2-1-3-8(4-7)6-10/h1-4H,5H2 | | InChIKey | WRXVOTDGLNPNND-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=CC(CCl)=C1 | | CAS DataBase Reference | 64407-07-4(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/38 | | Safety Statements | 26 | | RIDADR | 2923 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | II | | HS Code | 2926907090 |
| | M-CYANOBENZYL CHLORIDE Usage And Synthesis |
| Uses | 3-Cyanobenzyl chloride |
| | M-CYANOBENZYL CHLORIDE Preparation Products And Raw materials |
|