|
|
| | METHYL THIOPHENE-2-CARBOXYLATE Basic information |
| Product Name: | METHYL THIOPHENE-2-CARBOXYLATE | | Synonyms: | RARECHEM AL BF 0177;2-(Carbomethoxy)thiophene;2-(Methoxycarbonyl)thiophene;Thiophenate methyl;THIOPHENE-2-CARBOXYLIC ACID METHYL ESTER;2-THIOPHENECARBOXYLIC ACID METHYL ESTER;METHYL THIOPHENE-2-CARBOXYLATE;METHYL 2-THIOPHENECARBOXYLATE | | CAS: | 5380-42-7 | | MF: | C6H6O2S | | MW: | 142.18 | | EINECS: | 226-371-0 | | Product Categories: | Aromatic Esters | | Mol File: | 5380-42-7.mol |  |
| | METHYL THIOPHENE-2-CARBOXYLATE Chemical Properties |
| Boiling point | 94-96 °C (14 mmHg) | | density | 1,23 g/cm3 | | refractive index | 1.5405-1.5435 | | Fp | 95-97°C/15mm | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | clear liquid | | color | Colorless to Yellow | | BRN | 111111 | | InChI | InChI=1S/C6H6O2S/c1-8-6(7)5-3-2-4-9-5/h2-4H,1H3 | | InChIKey | PGBFYLVIMDQYMS-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)SC=CC=1 | | LogP | 1.830 | | CAS DataBase Reference | 5380-42-7(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 10 - Combustible liquids |
| | METHYL THIOPHENE-2-CARBOXYLATE Usage And Synthesis |
| Chemical Properties | clear light yellow liquid | | Definition | ChEBI: Methyl thiophene-2-carboxylate is a thiophenecarboxylic acid. |
| | METHYL THIOPHENE-2-CARBOXYLATE Preparation Products And Raw materials |
|