| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Zn(II) Octaethylporphine CAS:17632-18-7 Package:100Mg,1g,250Mg
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine zinc(II) CAS:17632-18-7 Purity:97% Package:100MG Remarks:258423-100MG
|
|
| | Zinc(II) 2,3,7,8,12,13,17,18-(octaethyl)porphyrin Basic information |
| Product Name: | Zinc(II) 2,3,7,8,12,13,17,18-(octaethyl)porphyrin | | Synonyms: | 2 3 7 8 12 13 17 18-OCTAETHYL-21H 23H-;2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphinezi;Zn-OEP complex;2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PO RPHINE ZINC(II), SYNTHETIC, 98%;octaethyl-21H,23H-porphine zinc(II);Zn(II) Octaethylporphine;Zinc(II) octaethylporphine;zinc octaethylporphyrin | | CAS: | 17632-18-7 | | MF: | C36H44N4Zn | | MW: | 598.16 | | EINECS: | | | Product Categories: | Photonic and Optical Materials;Phthalocyanine and Porphyrin Dyes;Porphyrines | | Mol File: | 17632-18-7.mol |  |
| | Zinc(II) 2,3,7,8,12,13,17,18-(octaethyl)porphyrin Chemical Properties |
| λmax | 400 nm | | InChIKey | VVUVWOLOUOYXOI-XTPDIVBZSA-N | | SMILES | CCc1c(CC)c2cc3c(CC)c(CC)c4cc5nc(cc6c(CC)c(CC)c(cc1n2)n6[Zn]n34)c(CC)c5CC |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Zinc(II) 2,3,7,8,12,13,17,18-(octaethyl)porphyrin Usage And Synthesis |
| Uses | 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine zinc(II) ) is formed by metalating 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine with zinc. | | General Description | 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine zinc(II) ) is formed by metalating 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine with zinc. |
| | Zinc(II) 2,3,7,8,12,13,17,18-(octaethyl)porphyrin Preparation Products And Raw materials |
|