1-BENZOYL-1H-BENZOTRIZOLE 97 manufacturers
|
| | 1-BENZOYL-1H-BENZOTRIZOLE 97 Basic information |
| | 1-BENZOYL-1H-BENZOTRIZOLE 97 Chemical Properties |
| Melting point | 110-112 °C | | Boiling point | 404.9±28.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | -0.40±0.30(Predicted) | | InChI | 1S/C13H9N3O/c17-13(10-6-2-1-3-7-10)16-12-9-5-4-8-11(12)14-15-16/h1-9H | | InChIKey | UJEMOXPSTTXLRE-UHFFFAOYSA-N | | SMILES | O=C(c1ccccc1)n2nnc3ccccc23 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-BENZOYL-1H-BENZOTRIZOLE 97 Usage And Synthesis |
| | 1-BENZOYL-1H-BENZOTRIZOLE 97 Preparation Products And Raw materials |
|