|
|
| | 5-Bromo-2-chlorobenzoic acid Basic information |
| | 5-Bromo-2-chlorobenzoic acid Chemical Properties |
| Melting point | 154-156 °C (lit.) | | Boiling point | 324.5±27.0 °C(Predicted) | | density | 1.7312 (rough estimate) | | refractive index | 1.5590 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | 2.63g/l | | pka | 2.49±0.25(Predicted) | | form | Solid | | color | Off white colored powder | | Water Solubility | Soluble in water 2.63 g/L @20°C. | | BRN | 2691432 | | InChI | InChI=1S/C7H4BrClO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) | | InChIKey | FGERXQWKKIVFQG-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(Br)=CC=C1Cl | | CAS DataBase Reference | 21739-92-4(CAS DataBase Reference) | | NIST Chemistry Reference | 5-Bromo-2-chlorobenzoic acid(21739-92-4) | | EPA Substance Registry System | Benzoic acid, 5-bromo-2-chloro- (21739-92-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163900 |
| | 5-Bromo-2-chlorobenzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 5-Bromo-2-chlorobenzoic acid was used to evaluate the homogeneity of organic powder. It can be used to produce 2-chloro-5-deuteriobenzoic acid. |
| | 5-Bromo-2-chlorobenzoic acid Preparation Products And Raw materials |
| Preparation Products | 5'-BROMO-2'-CHLOROACETOPHENONE-->5-BROMO-2-CHLORO-BENZOYL CHLORIDE-->EGT1442-->ETHYL 5-BROMO-2-CHLOROBENZOATE-->4-(5-broMo-2-chlorobenzyl)phenol-->2-(5-Bromo-2-chloro-phenyl)-1H-benzoimidazole-->(5-bromo-2-chlorophenyl)(4-fluorophenyl)methanone-->5-Bromo-2-chloro-N-cyclopropylbenzamide-->[1,1'-Biphenyl]-3-carboxylic acid, 4-chloro-3'-fluoro--->2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid-->(2S,3R,4R,5S,6R)-2-(4-chloro-3-((4-ethoxyphenyl)(methoxy) methyl)phenyl)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol-->(5-bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone |
|