|
|
| | 4-(Trifluoromethyl)benzene-1-sulfonyl chloride Basic information |
| | 4-(Trifluoromethyl)benzene-1-sulfonyl chloride Chemical Properties |
| Melting point | 30-34 °C(lit.) | | Boiling point | 76 °C | | density | 1.532±0.06 g/cm3(Predicted) | | Fp | 220 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Low Melting Solid | | color | White to pale yellow | | Sensitive | Moisture Sensitive | | BRN | 2113604 | | InChI | InChI=1S/C7H4ClF3O2S/c8-14(12,13)6-3-1-5(2-4-6)7(9,10)11/h1-4H | | InChIKey | OZDCZHDOIBUGAJ-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=CC=C(C(F)(F)F)C=C1 | | CAS DataBase Reference | 2991-42-6(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 22-26-36/37/39-45-26 36/37/3945 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Moisture Sensitive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 4-(Trifluoromethyl)benzene-1-sulfonyl chloride Usage And Synthesis |
| Chemical Properties | White ro pale yellow low melting solid | | Uses | 4-(Trifluoromethyl)benzenesulfonyl chloride may be used to synthesize β-arylated thiophenes and 2,5-diarylated pyrrolevia palladium catalyzed desulfitative arylation of thiophenes and pyrroles, respectively. 4-(Trifluoromethyl)benzenesulfonyl chloride and N-vinylpyrrolidinone in acetonitrile can undergo photo-irradiation with visible light in the presence of Ir(ppy)2(dtbbpy)PF6 ([4,4′-bis(1,1-dimethylethyl)-2,2′-bipyridine-N1,N1′]bis[2-(2-pyridinyl-N)phenyl-C]iridium(III)hexafluorophosphate) and disodium phosphate to give the corresponding E-vinyl sulfone. |
| | 4-(Trifluoromethyl)benzene-1-sulfonyl chloride Preparation Products And Raw materials |
|