|
|
| | 4-PHENYLAZOMALEINANIL Basic information |
| Product Name: | 4-PHENYLAZOMALEINANIL | | Synonyms: | 1-[4-(phenylazo)phenyl]-1h-pyrrole-5-dione;1H-Pyrrole-2,5-dione, 1-[4-(phenylazo)phenyl]-;N-(p-Phenylazophenyl)maleimide;P-PHENYLAZOMALEINANIL;ASISCHEM D13285;4-(N-Maleimido)azobenzene;4-PHENYLAZOMALEINANIL 97%;4-phenylazophenylmaleimide | | CAS: | 16201-96-0 | | MF: | C16H11N3O2 | | MW: | 277.28 | | EINECS: | 240-330-4 | | Product Categories: | P;Stains and Dyes;Stains&Dyes, A to | | Mol File: | 16201-96-0.mol |  |
| | 4-PHENYLAZOMALEINANIL Chemical Properties |
| Melting point | 162-165°C | | Boiling point | 475.1±28.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | room temp | | solubility | acetone: 25mg/mL, clear, orange | | form | crystals or chunks | | pka | -2.37±0.20(Predicted) | | BRN | 236610 | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C16H11N3O2/c20-15-10-11-16(21)19(15)14-8-6-13(7-9-14)18-17-12-4-2-1-3-5-12/h1-11H | | InChIKey | DVNPYLMPVFDKGZ-UHFFFAOYSA-N | | SMILES | O=C1C=CC(=O)N1c2ccc(cc2)N=Nc3ccccc3 | | EPA Substance Registry System | 1H-Pyrrole-2,5-dione, 1-[4-(phenylazo)phenyl]- (16201-96-0) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | 4-PHENYLAZOMALEINANIL Usage And Synthesis |
| Uses | diagnostic assay manufacturing
hematology
histology |
| | 4-PHENYLAZOMALEINANIL Preparation Products And Raw materials |
|