|
|
| | 4-ACETAMIDOANTIPYRINE Basic information |
| | 4-ACETAMIDOANTIPYRINE Chemical Properties |
| Melting point | 200-203 °C(lit.) | | Boiling point | 388.24°C (rough estimate) | | density | 1.1477 (rough estimate) | | refractive index | 1.5600 (estimate) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.84±0.20(Predicted) | | color | White to Off-White | | BRN | 234585 | | Major Application | pharmaceutical | | InChI | 1S/C13H15N3O2/c1-9-12(14-10(2)17)13(18)16(15(9)3)11-7-5-4-6-8-11/h4-8H,1-3H3,(H,14,17) | | InChIKey | OIAGWXKSCXPNNZ-UHFFFAOYSA-N | | SMILES | CN1N(C(=O)C(NC(C)=O)=C1C)c2ccccc2 | | CAS DataBase Reference | 83-15-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | 4-ACETAMIDOANTIPYRINE Usage And Synthesis |
| Chemical Properties | yellow powder | | Uses | A labelled metabolite of Metamizol. Metabolism of Metamizol in early stages of the incubated hen's egg. | | Uses | A metabolite of Metamizol. Metabolism of Metamizol in early stages of the incubated hen's egg. | | Definition | ChEBI: A member of the class of pyrazoles that is antipyrine substituted by an acetylamino group at position 4. It is a drug metabolite of metamizole. |
| | 4-ACETAMIDOANTIPYRINE Preparation Products And Raw materials |
|