|
|
| | Chloro(triphenylphosphine)gold Basic information |
| Product Name: | Chloro(triphenylphosphine)gold | | Synonyms: | Chloro(triphenylphosphine)gold(I), 99.9+% metals basis;Chloro(triphenylphosphine)gold(I), 99.9%;CHLORO(TRIPHENYLPHOSPHANE)GOLD(I);Triphenylphosphine aurous chloride;Chlorotriphenylphosphinegold(I),98+%(99.9+%-Au);chloro(triphenylphosphine)gold(i), premion;CHLOROTRIPHENYLPHOSPHINE GOLD(I) , (99.9%-AU);Chlorotriphenylphosphino gold | | CAS: | 14243-64-2 | | MF: | C18H15AuClP | | MW: | 494.71 | | EINECS: | 238-117-6 | | Product Categories: | Au;metal-phosphine complexes | | Mol File: | 14243-64-2.mol |  |
| | Chloro(triphenylphosphine)gold Chemical Properties |
| Melting point | 248-249°C | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | form | Crystalline Powder | | color | White | | Water Solubility | Soluble in methylene chloride, acetonitrile, benzene and acetone. Insoluble in water and ethanol. | | InChI | InChI=1S/C18H15P.Au.ClH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;;1H/q;+1;/p-1 | | InChIKey | IFPWCRBNZXUWGC-UHFFFAOYSA-M | | SMILES | P(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.Cl[Au] | | CAS DataBase Reference | 14243-64-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39-37/39 | | RIDADR | 3464 | | WGK Germany | 3 | | HS Code | 71159010 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | Chloro(triphenylphosphine)gold Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | Catalyst employed in the cyclization of O-propargyl carbamates to alkylideneoxazolidinones via a 5-exo-digonal pathway at room temperature. Also catalyzes the cycloisomerization of enynes containing a cyclic olefin into highly-fused, polycyclic dienes at room temperature. | | Uses | Chloro(triphenylphosphine)gold(I) is a common reagent in gold chemistry. It catalyzes certain rearrangement reactions in organic synthesis. It is also used to prepare 1-methylthyminato-N3-triphenylphosphinegold(I) by reacting with 1-methylthymine. It acts as a precursor for the synthesis of gold(I) and gold(III) organometallic compounds. | | reaction suitability | core: gold reagent type: catalyst |
| | Chloro(triphenylphosphine)gold Preparation Products And Raw materials |
|