- RARECHEM AL BO 0408
-
- $0.01 / 1KG
-
2020-01-10
- CAS:73016-08-7
- Min. Order: 1KG
- Purity: 98%; 99%
- Supply Ability: 500g;1kg; 25kg
|
| | 9,10-Anthracenedicarboxylic acid Basic information |
| Product Name: | 9,10-Anthracenedicarboxylic acid | | Synonyms: | 9,10-Anthracenedicarboxylic acid
;RARECHEM AL BO 0408;H2ADC;9,10-Anthracenedicarboxylic acid 95%;anthracene-9,10-dicarboxylic acid;DK7505;DK7726;9,10-Anthraacenedicarboxylic acid | | CAS: | 73016-08-7 | | MF: | C16H10O4 | | MW: | 266.25 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 9,10-Anthracenedicarboxylic acid Chemical Properties |
| Melting point | >300°C | | Boiling point | 595.1±23.0 °C(Predicted) | | density | 1.457±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 2.69±0.30(Predicted) | | form | solid | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C16H10O4/c17-15(18)13-9-5-1-2-6-10(9)14(16(19)20)12-8-4-3-7-11(12)13/h1-8H,(H,17,18)(H,19,20) | | InChIKey | FDFGHPKPHFUHBP-UHFFFAOYSA-N | | SMILES | C1=C2C(C(C(O)=O)=C3C(=C2C(O)=O)C=CC=C3)=CC=C1 |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 |
| | 9,10-Anthracenedicarboxylic acid Usage And Synthesis |
| Uses | H2L can be potentially used in the formation of highly porous nanotubular and ultramicroporous metal organic frameworks (MOFs) for greener applications like hydrogen storage, methane storage and gas separation. | | General Description | 9,10-Anthracenedicarboxylic acid (H2L) is an anthracene based dicarboxylic compound, which has a larger conjugating π-system that enables the development of fluorescent materials. It has interesting magnetic and luminescent properties. It can be used as a bridging carboxylic acid ligand with a steric bulk due to the presence of its anthracene ring. |
| | 9,10-Anthracenedicarboxylic acid Preparation Products And Raw materials |
|