|
|
| | 1,6-BISMALEIMIDOHEXANE Basic information |
| Product Name: | 1,6-BISMALEIMIDOHEXANE | | Synonyms: | 1,6-BISMALEIMIDOHEXANE;1,6-HEXANE DIMALEIMIDE;N,N'-HEXAMETHYLENEBISMALEIMIDE;N,N'-HEXAMETHYLENEDIMALEIMIDE;1,1'-(hexane-1,6-diyl)bis-1H-pyrrole-2,5-dione;1,6-Bis(maleimide)hexane;Hmdm;BIS-MALEIMIDOHEXANE | | CAS: | 4856-87-5 | | MF: | C14H16N2O4 | | MW: | 276.29 | | EINECS: | 225-449-1 | | Product Categories: | pharmacetical;Maleimide Derivatives;N-Substituted Maleimides;N-Substituted Maleimides, Succinimides & Phthalimides;Cross Linking Reagents;MTS & Sulfhydryl Active Reagents | | Mol File: | 4856-87-5.mol |  |
| | 1,6-BISMALEIMIDOHEXANE Chemical Properties |
| Melting point | 144 °C | | Boiling point | 419.2°C (rough estimate) | | density | 1.1933 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | 0-6°C | | solubility | Soluble in chloroform. | | pka | -1.90±0.20(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C14H16N2O4/c17-11-5-6-12(18)15(11)9-3-1-2-4-10-16-13(19)7-8-14(16)20/h5-8H,1-4,9-10H2 | | InChIKey | PYVHLZLQVWXBDZ-UHFFFAOYSA-N | | SMILES | C(N1C(=O)C=CC1=O)CCCCCN1C(=O)C=CC1=O | | CAS DataBase Reference | 4856-87-5(CAS DataBase Reference) | | EPA Substance Registry System | 1H-Pyrrole-2,5-dione, 1,1'-(1,6-hexanediyl)bis- (4856-87-5) |
| RTECS | ON5520000 | | HS Code | 29251900 | | Toxicity | mouse,LD50,oral,215mg/kg (215mg/kg),Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 40(11), Pg. 109, 1975. |
| | 1,6-BISMALEIMIDOHEXANE Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A sulfhydryl reactive homobifunctional cross linking reagent. Under mild conditions, will permit irreversible cross-linking of sulfhydral containing compounds at a pH range of 6.5 to 7.5. | | Uses | A sulfhydryl reactive homobifunctional crosslinking reagent. Under mild conditions, will permit irreversible cross-linking of sulfhydral containing compounds at a pH range of 6.5 to 7.5.
Spacer Arm: 16.1 Angstroms |
| | 1,6-BISMALEIMIDOHEXANE Preparation Products And Raw materials |
|