HYOSCINE HYDROCHLORIDE manufacturers
- HYOSCINE HYDROCHLORIDE
-
- $1.00 / 1KG
-
2019-12-23
- CAS:55-16-3
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10t
|
| | HYOSCINE HYDROCHLORIDE Basic information |
| Product Name: | HYOSCINE HYDROCHLORIDE | | Synonyms: | SCOPINE TROPATE HYDROCHLORIDE;SCOPINE TROPATE;(-)-SCOPOLAMINE HYDROCHLORIDE;SCOPOLAMINE HYDROCHLORIDE;HYOSCINE HYDROCHLORIDE;0(sup2,4))non-7-ylester,hydrochloride,(7(s)-(1-alpha,2-beta,4-beta,5-alpha;5-alpha-h-tropan-3-alpha-ol,6-beta,7-beta-epoxy-1-alpha-(-)-tropate(est;chlorhydratedescopolamine | | CAS: | 55-16-3 | | MF: | C17H22ClNO4 | | MW: | 339.81 | | EINECS: | 200-225-6 | | Product Categories: | Pyrrolidines ,Pyrroles | | Mol File: | 55-16-3.mol |  |
| | HYOSCINE HYDROCHLORIDE Chemical Properties |
| Melting point | 200° | | Fp | 77 °C | | storage temp. | -20°C | | solubility | H2O: 50 mg/mL | | form | powder | | color | white | | Optical Rotation | [α]25/D ~ 27°, c = 1 in H2O(lit.) | | Water Solubility | H2O: 50mg/mL | | BRN | 4168778 | | InChI | 1S/C17H21NO4.ClH/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10;/h2-6,11-16,19H,7-9H2,1H3;1H/t11-,12-,13-,14+,15-,16+;/m1./s1 | | InChIKey | KXPXJGYSEPEXMF-MOUKNHLCSA-N | | SMILES | Cl.[H][C@]12C[C@H](C[C@]([H])(N1C)[C@]3([H])O[C@]23[H])OC(=O)[C@H](CO)c4ccccc4 | | CAS DataBase Reference | 55-16-3(CAS DataBase Reference) |
| Hazard Codes | T+ | | Risk Statements | 26/27/28 | | Safety Statements | 25-45-36/37-28 | | RIDADR | UN 1544 6.1/PG 3 | | WGK Germany | 3 | | RTECS | CY1634501 | | F | 3-8 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Eye Dam. 1 Skin Sens. 1 |
| | HYOSCINE HYDROCHLORIDE Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents. | | Uses | Antiemetic;Non-selective muscarinic antagonist | | Biochem/physiol Actions | Competitive nonselective muscarinic acetylcholine antagonist. Scopolamine-induced amnesia in laboratory animals is a commonly-used model of memory deficit. | | in vivo | Scopolamine induces memory impairment associated with attenuation of cholinergic neurotransmission, as well as an increases of processes connected with oxidative stress in the brain[3]. | Animal Model: | Naive male Swiss mice weighing 20-25[3] | | Dosage: | 1 mg/kg | | Administration: | Administered intraperitoneally (i.p.); to measure the memory acquisition processes, Scopolamine was administered 20 min before the pretest; to measure the memory consolidation processes, Scopolamine was administered immediately after the pretest | | Result: | In scopolamine-treated group, there was a significant decrease in the index of latency (IL) value as compared with the saline-treated mice, indicating that scopolamine at the used dose impaired acquisition of memory and learning. |
| | IC 50 | 5-HT3 Receptor: 2.09 μM (IC50) |
| | HYOSCINE HYDROCHLORIDE Preparation Products And Raw materials |
|