|
|
| | 5'-O-Dimethoxytrityl-deoxythymidine Basic information |
| | 5'-O-Dimethoxytrityl-deoxythymidine Chemical Properties |
| Melting point | 114-116 °C (subl.)(lit.) | | Boiling point | 618.41°C (rough estimate) | | density | 1.2483 (rough estimate) | | vapor pressure | 0Pa at 20℃ | | refractive index | 7 ° (C=1, MeOH) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 9.55±0.10(Predicted) | | form | Powder | | color | White to off-white | | Water Solubility | 3mg/L at 20℃ | | BRN | 599297 | | Stability: | Store in Freezer | | InChIKey | UBTJZUKVKGZHAD-UPRLRBBYSA-N | | SMILES | COc1ccc(cc1)C(OC[C@H]2O[C@H](C[C@@H]2O)N3C=C(C)C(=O)NC3=O)(c4ccccc4)c5ccc(OC)cc5 | | LogP | 4.61 at 20℃ | | CAS DataBase Reference | 40615-39-2(CAS DataBase Reference) | | EPA Substance Registry System | Thymidine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]- (40615-39-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 1-3-10 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29349990 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | 5'-O-Dimethoxytrityl-deoxythymidine Usage And Synthesis |
| Chemical Properties | White Powder | | Uses | 5'-O-(4,4'-Dimethoxytrityl)thymidine is used in the solid-phase synthesis of polynucleotides and polythymidylic acids by the block coupling phosphotriester method. Further, it is used in the stereoselective synthesis of 3'-deoxy-3'-threo-hydroxymethyl nucleoside. In addition to this, it is used as a research tool for antiviral and anticancer studies. | | General Description | 5′-O-(4,4′-Dimethoxytrityl)thymidine is a pyrimidine. | | Flammability and Explosibility | Not classified |
| | 5'-O-Dimethoxytrityl-deoxythymidine Preparation Products And Raw materials |
|