|
|
| | Methyl-(4-methyl-thiazol-2-ylmethyl)-amine dihydrochloride Basic information |
| Product Name: | Methyl-(4-methyl-thiazol-2-ylmethyl)-amine dihydrochloride | | Synonyms: | N-Methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine dihydrochloride;N-methyl-1-(4-methylthiazol-2-yl)methanamine dihydrochloride;N-methyl-1-(4-methylthiazol-2-yl)methanamine;N-methyl(4-methylthiazol-2-yl)methanamine;2-Thiazolemethanamine, N,4-dimethyl-;N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine;Methyl[(4-methyl-1,3-thiazol-2-yl)methyl]amine;N-Methyl-1-(4-methyl-2-thiazolyl)methanamine | | CAS: | 644950-37-8 | | MF: | C6H10N2S | | MW: | 142.22 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Methyl-(4-methyl-thiazol-2-ylmethyl)-amine dihydrochloride Chemical Properties |
| form | solid | | InChI | 1S/C6H10N2S.2ClH/c1-5-4-9-6(8-5)3-7-2;;/h4,7H,3H2,1-2H3;2*1H | | InChIKey | HUPIALUKIPJUPK-UHFFFAOYSA-N | | SMILES | CC1=CSC(CNC)=N1.[H]Cl.[H]Cl |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Methyl-(4-methyl-thiazol-2-ylmethyl)-amine dihydrochloride Usage And Synthesis |
| | Methyl-(4-methyl-thiazol-2-ylmethyl)-amine dihydrochloride Preparation Products And Raw materials |
|