- Captopril EP Impurity J
-
- $10.00 / 1kg
-
2025-09-25
- CAS:64838-55-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | (2S)-1-(3-Acetylthio-2-methyl-1-oxopropyl)-L-proline Basic information |
| | (2S)-1-(3-Acetylthio-2-methyl-1-oxopropyl)-L-proline Chemical Properties |
| Melting point | 76-82 °C(lit.) | | alpha | -158 º (c=1, MeOH) | | Boiling point | 464.8±40.0 °C(Predicted) | | density | 1.291±0.06 g/cm3(Predicted) | | refractive index | -160 ° (C=1, MeOH) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 3.56±0.20(Predicted) | | color | White | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C11H17NO4S/c1-7(6-17-8(2)13)10(14)12-5-3-4-9(12)11(15)16/h7,9H,3-6H2,1-2H3,(H,15,16)/p-1/t7-,9+/m1/s1 | | InChIKey | ZNQRGUYIKSRYCI-APPZFPTMSA-M | | SMILES | S(C[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)[O-])C(=O)C | | CAS DataBase Reference | 64838-55-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 24/25-26 | | WGK Germany | 3 | | HS Code | 2933.99.9701 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 2
Skin Sens. 1
STOT RE 1 Oral |
| | (2S)-1-(3-Acetylthio-2-methyl-1-oxopropyl)-L-proline Usage And Synthesis |
| Chemical Properties | white fine powder | | Uses | (2S)-1-(3-Acetylthio-2-methyl-1-oxopropyl)-L-proline is used in the preparation of captopril derivatives, used as angiotensin converting enzymes. |
| | (2S)-1-(3-Acetylthio-2-methyl-1-oxopropyl)-L-proline Preparation Products And Raw materials |
|