|
|
| | 3,4'-Dichlorodiphenyl ether Basic information |
| | 3,4'-Dichlorodiphenyl ether Chemical Properties |
| Melting point | -10 °C | | Boiling point | 113°C (0.5 mmHg) | | density | 1.29 | | refractive index | 1.5950 | | storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C12H8Cl2O/c13-9-4-6-11(7-5-9)15-12-3-1-2-10(14)8-12/h1-8H | | InChIKey | HPRGYUWRGCTBAV-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=CC(OC2=CC=C(Cl)C=C2)=C1 | | CAS DataBase Reference | 6842-62-2(CAS DataBase Reference) |
| | 3,4'-Dichlorodiphenyl ether Usage And Synthesis |
| Chemical Properties | Colorless or light yellow oily liquid | | Synthesis | The general steps for synthesizing 3,4'-dichlorodiphenyl ether from p-chlorophenol and 1,3-dichlorobenzene are as follows: first, the organic solvent was prepared by mixing ionic liquid with dipropylene glycol methyl ethyl ether in a mass ratio of 1:20. The specific synthesis method is as follows: (1) A copper salt catalyst is added to the reaction system, while 1,3-dichlorobenzene, p-chlorophenol, a base and the organic solvent prepared above are mixed. Among them, the molar ratio of 1,3-dichlorobenzene, p-chlorophenol, potassium carbonate base and cuprous chloride salt was 6:1:1.2:0.01, and the total dosage of organic solvent was 10% of the total amount of the reactants; (2) under microwave-catalyzed conditions, the reaction mixture was stirred for 2 hours at 500 W power, and the temperature of the reaction was controlled at 60~110°C. The reaction temperature was controlled at 60~110°C. The reaction temperature was set to 0.01 °C for 2 hours. After the reaction was completed, the mixture was left to cool, filtered, and the filtrate was distilled under reduced pressure to collect a colorless and transparent liquid product. The conversion of the method was 99% and the yield was 93%. | | References | [1] Patent: CN105198713, 2017, B. Location in patent: Paragraph 0024-0044 |
| | 3,4'-Dichlorodiphenyl ether Preparation Products And Raw materials |
|