|
| 1-Amino-1-cyclobutanecarboxylic acid hydrochloride Basic information |
| 1-Amino-1-cyclobutanecarboxylic acid hydrochloride Chemical Properties |
Melting point | 226 °C | RTECS | GU1336000 | storage temp. | Inert atmosphere,2-8°C | Water Solubility | Soluble in water | form | Powder | color | White to Almost white | InChI | InChI=1S/C5H9NO2.ClH/c6-5(4(7)8)2-1-3-5;/h1-3,6H2,(H,7,8);1H | InChIKey | HBTVGNDTGRUBQO-UHFFFAOYSA-N | SMILES | C1(N)(C(O)=O)CCC1.[H]Cl |
| 1-Amino-1-cyclobutanecarboxylic acid hydrochloride Usage And Synthesis |
Uses | NMDA receptor antagonist acting at the glycine site |
| 1-Amino-1-cyclobutanecarboxylic acid hydrochloride Preparation Products And Raw materials |
|