- 6-BROMONAPHTHALEN-2-AMINE
-
- $50.00 / 1KG
-
2023-12-23
- CAS:7499-66-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 6-BROMONAPHTHALEN-2-AMINE Basic information |
| Product Name: | 6-BROMONAPHTHALEN-2-AMINE | | Synonyms: | 6-Bromo-2-naphthylamine, 6-Bromonaphthalen-2-amine;6-BroMo-2-naphthalenaMine;NSC 407685;6-broMo-2-aMinonaphthalene;2-Amino-6-bromophthalene;2-Amino-6-bromonaphthalene;6-Bromonaphthalen-2-ylamine;6-Bromonaphthalen-2-amine | | CAS: | 7499-66-3 | | MF: | C10H8BrN | | MW: | 222.08 | | EINECS: | 1308068-626-2 | | Product Categories: | Aromatics;Amines;7499-66-3 | | Mol File: | 7499-66-3.mol |  |
| | 6-BROMONAPHTHALEN-2-AMINE Chemical Properties |
| Melting point | 128 °C | | Boiling point | 155-160 °C(Press: 1 Torr) | | density | 1.563±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | solid | | pka | 3.66±0.10(Predicted) | | color | grey | | InChI | InChI=1S/C10H8BrN/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1-6H,12H2 | | InChIKey | UBLKHAWYJFEPDX-UHFFFAOYSA-N | | SMILES | C1=C2C(C=C(Br)C=C2)=CC=C1N |
| Hazard Note | Irritant | | HS Code | 2921450090 |
| | 6-BROMONAPHTHALEN-2-AMINE Usage And Synthesis |
| Uses | 6-Bromonaphthalen-2-amine is used in the new synthesis of alkylsulphanylnaphthalenes and the synthesis and mesomorphic properties of novel naphthylisothiocyanates. | | Application | 6-Bromonaphthalen-2-amine can be used to prepare light-emitting diode materials, amine compounds, deuterated aromatic compounds and deuterated compositions thereof. |
| | 6-BROMONAPHTHALEN-2-AMINE Preparation Products And Raw materials |
|