|
|
| | 2-Oxotetrahydrofuran-3-yl methacrylate Basic information |
| Product Name: | 2-Oxotetrahydrofuran-3-yl methacrylate | | Synonyms: | alpha-Methacryloxy-gama-butyrolactone;2-Propenoic acid, 2-Methyl-, tetrahydro-2-oxo-3-furanyl ester;2-Methylacrylic acid 2-oxo-tetrahydrofuran-3-yl ester;A-METHYACRYLOYLOXY-|-BUTYLOLACTONE;GBLMA (stabilized with BHT);a-GBLMA 2-Propenoic acid, 2-methyl-, tetrahydro-2-oxo-3-furanyl ester In stock Factory ArF monomers;alpha-Methacryloxy-gama-butyrolactone 195000-66-9;2-Oxotetrahydrofuran-3-yl methacrylate 195000-66-9 | | CAS: | 195000-66-9 | | MF: | C8H10O4 | | MW: | 170.16 | | EINECS: | | | Product Categories: | | | Mol File: | 195000-66-9.mol |  |
| | 2-Oxotetrahydrofuran-3-yl methacrylate Chemical Properties |
| Boiling point | 296.8±33.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | Fp | 152 °C | | storage temp. | Refrigerated | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 1.19 | | InChI | InChI=1S/C8H10O4/c1-5(2)7(9)12-6-3-4-11-8(6)10/h6H,1,3-4H2,2H3 | | InChIKey | QSUJHKWXLIQKEY-UHFFFAOYSA-N | | SMILES | C(OC1CCOC1=O)(=O)C(C)=C |
| | 2-Oxotetrahydrofuran-3-yl methacrylate Usage And Synthesis |
| Uses | 2-Oxotetrahydrofuran-3-yl methacrylate is mainly used as a raw material for the synthesis of organic materials, and can be used for the synthesis of Dimethyl 2,2'-azobis(2-methylpropionate), which is generally used for experimental research. |
| | 2-Oxotetrahydrofuran-3-yl methacrylate Preparation Products And Raw materials |
|