|
| 1-(2-NAPHTHYL)METHANAMINE Basic information |
Product Name: | 1-(2-NAPHTHYL)METHANAMINE | Synonyms: | 1-(2-NAPHTHYL)METHANAMINE;C-NAPHTHALEN-2-YL-METHYLAMINE;RARECHEM AL BW 0300;Naphthyl methanamine;2-AMinoMethyl naphthalene;naphthalen-2-ylmethylamine;naphthalen-2-ylMethanaMine;2-Naphthalenemethanamine (9CI, ACI) | CAS: | 2018-90-8 | MF: | C11H11N | MW: | 157.21 | EINECS: | 241-580-7 | Product Categories: | | Mol File: | 2018-90-8.mol | |
| 1-(2-NAPHTHYL)METHANAMINE Chemical Properties |
Melting point | 59.5°C | Boiling point | 271.88°C (rough estimate) | density | 1.0595 (rough estimate) | refractive index | 1.6722 (estimate) | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | pka | 9.06±0.30(Predicted) | form | solid | color | Yellow | InChI | InChI=1S/C11H11N/c12-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7H,8,12H2 | InChIKey | XBCAHQUVHHHHHHL-UHFFFAOYSA-N | SMILES | C1=CC=C2C=C(C=CC2=C1)CN |
| 1-(2-NAPHTHYL)METHANAMINE Usage And Synthesis |
Uses | 1-(2-Naphthyl)methanamine can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development and chemical production process. |
| 1-(2-NAPHTHYL)METHANAMINE Preparation Products And Raw materials |
|