β-nicotinamide mononucleotide, reduced form, disodium salt(NMNH) manufacturers
|
| | β-nicotinamide mononucleotide, reduced form, disodium salt(NMNH) Basic information |
| Product Name: | β-nicotinamide mononucleotide, reduced form, disodium salt(NMNH) | | Synonyms: | β-nicotinamide mononucleotide, reduced form, disodium salt(NMNH);NMNH β-nicotinamide mononucleotide, reduced form, disodium salt;β-nicotinamide mononucleotide, reduced form, disodium salt;NMNH;β-Nicotinamide mononucleotide, reduced form;NMNH(β-Nicotinamide mononucleotide Reduced );β-nicoChemicalbooktinamidemononucleotide,reducedform,disodiumsalt;β-Nicotinamide mononucleotide Reduced | | CAS: | 108347-85-9 | | MF: | C11H18N2NaO8P | | MW: | 360.23 | | EINECS: | | | Product Categories: | | | Mol File: | 108347-85-9.mol |  |
| | β-nicotinamide mononucleotide, reduced form, disodium salt(NMNH) Chemical Properties |
| InChIKey | LSKSZICSFLRXJW-RAJFINMANA-N | | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(O)=O)O[C@H]1N1C=CCC(C(=O)N)=C1)O.[NaH] |&1:1,2,3,11,r| |
| | β-nicotinamide mononucleotide, reduced form, disodium salt(NMNH) Usage And Synthesis |
| Description | NMNH (reduced Nicotinamide Mononucleotide) is a new potent NAD+ precursor. It is a new form of NMN, can increase NAD levels to a much higher extent.
NMNH is a fluorescent molecule, in contrast to NMN. The molecular formulae for NMNH is C11H17N2O8P and it is also known as 1-(5-O-phosphono-beta-D-ribofuranosyl) -1,4-dihydropyridine-3-carboxamide Reduced nicotinamide mononucleotide. | | storage | 2-8°C |
| | β-nicotinamide mononucleotide, reduced form, disodium salt(NMNH) Preparation Products And Raw materials |
|