|
|
| | 2-Cyanoethyl N,N-diisopropylchlorophosphoramidite Basic information |
| | 2-Cyanoethyl N,N-diisopropylchlorophosphoramidite Chemical Properties |
| Boiling point | 103-105°C 0,08mm | | density | 1.061 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.479 | | Fp | >230 °F | | storage temp. | −20°C | | solubility | Miscible with chloroform and dichloromethane. | | form | Crystalline Powder | | pka | 0.83±0.70(Predicted) | | color | clear to very slightly hazy colorless | | Sensitive | Moisture Sensitive | | BRN | 3588525 | | Stability: | Hygroscopic, Moisture Sensitive | | InChI | InChI=1S/C9H18ClN2OP/c1-8(2)12(9(3)4)14(10)13-7-5-6-11/h8-9H,5,7H2,1-4H3 | | InChIKey | QWTBDIBOOIAZEF-UHFFFAOYSA-N | | SMILES | P(N(C(C)C)C(C)C)(Cl)OCCC#N | | CAS DataBase Reference | 89992-70-1(CAS DataBase Reference) |
| | 2-Cyanoethyl N,N-diisopropylchlorophosphoramidite Usage And Synthesis |
| Chemical Properties | Slightly Hazy Yellow Liquid | | Uses | A protecting reagent in DNA synthesis. Also a phosphorylating agent | | Uses | 2-Cyanoethyl diisopropylchlorophosphoramidite is a useful intermediate in organic synthesis. It acts as a protecting reagent in DNA synthesis. It is involved in the selective monophosphorylation of carbohydrates and nucleosides. It plays an essential role in the conversion of protected ribonucleosides to phosphoramidites. It is also utilized as phosphitylating reagent for 3'-hydroxyl groups in the synthesis of oligodeoxyribonucleotides. |
| | 2-Cyanoethyl N,N-diisopropylchlorophosphoramidite Preparation Products And Raw materials |
|