- 2-CARBOMETHOXY-3-TROPINONE
-
- $1.00 / 1g
-
2024-04-26
- CAS:36127-17-0
- Min. Order: 1g
- Purity: 99%Dorne chemical technology co., LTD.
- Supply Ability: 100kg
|
| | 2-CARBOMETHOXY-3-TROPINONE Basic information |
| Product Name: | 2-CARBOMETHOXY-3-TROPINONE | | Synonyms: | CARBOMETHOXY-TROPINONE;2-CARBOMETHOXY-3-TROPINONE;CARBMETHOXY-TROPINONE;Methyl 8-Methyl-3-oxobicyclo[3.2.1]octane-2-carboxylate;8-Azabicyclo[3.2.1]octane-2-carboxylicacid, 8-Methyl-3-oxo-, Methyl ester;8-methyl-3-oxo-8-azabicyclo[3.2.1]octane-2-COOMe;Methyl 8-Methyl-3-oxo-8-azabicyclo[3.2.1]octane-4-carboxylate;2-(Methoxycarbonyl)-3-tropanone | | CAS: | 36127-17-0 | | MF: | C10H15NO3 | | MW: | 197.23 | | EINECS: | 237-344-8 | | Product Categories: | pharmacetical | | Mol File: | 36127-17-0.mol |  |
| | 2-CARBOMETHOXY-3-TROPINONE Chemical Properties |
| Melting point | 104℃ (approx) | | Boiling point | 92-95 °C(Press: 0.3 Torr) | | density | 1.173±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | pka | 10.89±0.20(Predicted) | | form | Solid | | color | Light Brown to Brown | | InChI | InChI=1S/C10H15NO3/c1-11-6-3-4-7(11)9(8(12)5-6)10(13)14-2/h6-7,9H,3-5H2,1-2H3 | | InChIKey | WXEMSGQRTGSYOG-UHFFFAOYSA-N | | SMILES | C12N(C)C(CC1)CC(=O)C2C(OC)=O |
| | 2-CARBOMETHOXY-3-TROPINONE Usage And Synthesis |
| Description | 2-Carbomethoxy-3-tropinone is an advanced intermediate in the biosynthesis of cocaine. | | Uses | 2-carbomethoxy-3-tropinone is an intermediate in the synthesis of cocaine isomers at the cocaine receptor. |
| | 2-CARBOMETHOXY-3-TROPINONE Preparation Products And Raw materials |
|