|
|
| | Methyltriphenylphosphonium iodide Basic information |
| | Methyltriphenylphosphonium iodide Chemical Properties |
| Melting point | 183-185 °C(lit.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Powder | | color | White to light yellow | | Water Solubility | SOLUBLE | | Sensitive | Light Sensitive & Hygroscopic | | InChI | InChI=1S/C19H18P.HI/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;/h2-16H,1H3;1H/q+1;/p-1 | | InChIKey | JNMIXMFEVJHFNY-UHFFFAOYSA-M | | SMILES | [P+](C)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1.[I-] | | CAS DataBase Reference | 2065-66-9(CAS DataBase Reference) |
| | Methyltriphenylphosphonium iodide Usage And Synthesis |
| Chemical Properties | WHITE TO LIGHT YELLOW POWDER | | Uses | Methyltriphenylphosphonium iodide is as a reactant for synthesis of triphenylamine-based dyes and polyolefinic aromatic molecules with pyrene for use in dye-sensitized solar cells. Used as ligand in coupling reaction. It is also used as a precursor to a Wittig reagent. | | Uses | suzuki reaction |
| | Methyltriphenylphosphonium iodide Preparation Products And Raw materials |
|