|
|
| | Metomidate Hydrochloride Basic information |
| Product Name: | Metomidate Hydrochloride | | Synonyms: | 1H-Imidazole-5-carboxylic acid,1-(1-phenylethyl)-,methyl ester,hydrochloride(1:1);1H-Imidazole-5-carboxylic acid, 1-(1-phenylethyl)-, methyl ester, monohydrochloride;Nsc168403;Metomidate Hydrochloride (50 mg) (methyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate hydrochloride);Methyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate hydrochloride;Metomidate Hydrochloride (methyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate hydrochloride) (1268772);1H-Imidazole-4-carboxylicacid,1-(10-bromophenyl)-;1-(1-phenylethyl)-1H-Imidazole-5-carboxylic acid methyl ester hydrochloride (1:1) | | CAS: | 35944-74-2 | | MF: | C13H14N2O2.ClH | | MW: | 266.727 | | EINECS: | | | Product Categories: | | | Mol File: | 35944-74-2.mol |  |
| | Metomidate Hydrochloride Chemical Properties |
| Melting point | 173-174 °C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetone (Slightly), Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C13H14N2O2.ClH/c1-10(11-6-4-3-5-7-11)15-9-14-8-12(15)13(16)17-2;/h3-10H,1-2H3;1H | | InChIKey | NZEDTZKNEKPBGR-UHFFFAOYSA-N | | SMILES | N1(C=NC=C1C(=O)OC)C(C)C1=CC=CC=C1.Cl |
| | Metomidate Hydrochloride Usage And Synthesis |
| Uses | Metomidate Hydrochloride is used as an anesthetic for veterinary use. | | Uses | Metomidate hydrochloride is an imidazole-based, nonbarbiturate hypnotic drug primarily used as an immersion sedation and anesthetic agent in freshwater and marine finfish. Adding sedatives, such as metomidate hydrochloride, to shipping water may improve fish survival rates and the percentage of fish in saleable condition. | | Mechanism of action | As mentioned earlier, metomidate has been suggested to block the stress response. Imidazole anesthetics (e.g., metomidate and etomidate) interrupt cortisol synthesis in mammals by suppressing the enzyme 11-beta-hydroxylase, which is necessary for cortisol production. |
| | Metomidate Hydrochloride Preparation Products And Raw materials |
|