|
|
| | 1,3-Benzenedisulfonyl Chloride Basic information |
| Product Name: | 1,3-Benzenedisulfonyl Chloride | | Synonyms: | BENZENE-1,3-DISULFONYL CHLORIDE;BENZENE-1,3-DISULFONYL DICHLORIDE;1,3-BENZENEDISULFONYL CHLORIDE;1,3-BENZENEDISULFONYL DICHLORIDE;1,3-BENZENEDISULPHONYL CHLORIDE;benzene-1,3-disulphonyl dichloride;1,3-BENZENEDISULFONYL CHLORIDE 97+% T;1,3-Benzenedisulphonylchloride,98% | | CAS: | 585-47-7 | | MF: | C6H4Cl2O4S2 | | MW: | 275.13 | | EINECS: | 209-556-0 | | Product Categories: | Aromatics;Sulfonyl Chlorides;Organic Building Blocks;Sulfonyl Halides;Sulfur Compounds | | Mol File: | 585-47-7.mol |  |
| | 1,3-Benzenedisulfonyl Chloride Chemical Properties |
| Melting point | 57-60 °C(lit.) | | Boiling point | 145 °C / 1mmHg | | density | 1.6494 (estimate) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Dichloromethane, DMSO | | form | solid | | color | Off-White to Light Brown | | Water Solubility | Soluble in DMSO and methanol. Reacts with water. | | Sensitive | Moisture Sensitive | | BRN | 1118508 | | InChI | InChI=1S/C6H4Cl2O4S2/c7-13(9,10)5-2-1-3-6(4-5)14(8,11)12/h1-4H | | InChIKey | ALIQZUMMPOYCIS-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=CC=CC(S(Cl)(=O)=O)=C1 | | CAS DataBase Reference | 585-47-7(CAS DataBase Reference) | | EPA Substance Registry System | 1,3-Benzenedisulfonyl dichloride (585-47-7) |
| Hazard Codes | C | | Risk Statements | 34-37-42/43 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 3-21 | | TSCA | Yes | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 |
| | 1,3-Benzenedisulfonyl Chloride Usage And Synthesis |
| Chemical Properties | Light Brown Solid | | Uses | 1,3-Benzenedisulfonyl chloride is used as a pharmaceutical intermediates. The compound is used to produce1,3-benzenedisulfonohydrazide. | | Production Methods | Manufactured from m-benzenedisulfonic acid and phosphorus pentachloride or from benzenesulfochloride andchlorosulfuric acid. | | General Description | Benzene-1,3-disulfonyl chloride (BDD) or 1,3-benzenedisulfonyl chloride is dichloride of 1,3-benzenedisulfonic acid. It is a colorless (white) crystalline solid with a melting point of 59-62 °C. It is soluble in common organic solvents. Compounds are sensitive to moisture and react in water; therefore, they should be stored in dry conditions. It has corrosive properties and can cause severe skin burns and eye damage. | | Purification Methods | Crystallise it from CHCl3 (EtOH free, by passing through an alumina column) or *C6H6/pet ether and dry it at 20mm pressure. [Beilstein 11 IV 553.] |
| | 1,3-Benzenedisulfonyl Chloride Preparation Products And Raw materials |
|