|
| 5-Nitrofluorescein Basic information |
| 5-Nitrofluorescein Chemical Properties |
solubility | Acetone, Methanol | form | Solid | color | Orange Cyrstalline | Stability: | Light and Moisture Sensitive | InChI | InChI=1S/C20H11NO7/c22-11-2-5-14-17(8-11)27-18-9-12(23)3-6-15(18)20(14)16-7-10(21(25)26)1-4-13(16)19(24)28-20/h1-9,22-23H | InChIKey | GYWGQAIDMYGOLU-UHFFFAOYSA-N | SMILES | C12(C3=C(C=C(O)C=C3)OC3=C1C=CC(O)=C3)C1=C(C=CC([N+]([O-])=O)=C1)C(=O)O2 | EPA Substance Registry System | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-6-nitro- (27402-68-2) |
| 5-Nitrofluorescein Usage And Synthesis |
Chemical Properties | Orange Cyrstalline Solid | Uses | Fluorescent labeling reagent for proteins, 6-Nitrofluorescein can be used in the fluorescent antibody technique for rapid identification of pathogens. | Preparation | 5-Nitrofluorescein (3′,6′-dihydroxy-6-nitrospiro[2-benzofuran-3,9′-xanthene]-1-one) is a key intermediate in the synthesis of various fluorescent compounds such as 5-aminofluorescein (5-amino-3′,6′-dihydroxy-3H-spiro[isobenzofuran-1,9′-xanthen]-3-one), fluorescein 5-isothiocyanate (FITC; 3′,6′-dihydroxy-5-isothiocyanato-3H-spiro[isobenzofuran-1,9′-xanthen]-3-one), and fluorescein lisicol (previously known as cholyl-lysylfluorescein or CLF. Process for the preparation of 5-/6-nitrofluorescein(US20120220787A1) |
| 5-Nitrofluorescein Preparation Products And Raw materials |
|