| Company Name: |
Synchem OHG
|
| Tel: |
+49 5662 408730 |
| Email: |
info@synchem.de |
| Products Intro: |
Product Name:2-Hydroxy-3-nitronaphthalene
CAS:32361-60-7
|
|
| | 3-Nitro-2-naphthol Basic information |
| Product Name: | 3-Nitro-2-naphthol | | Synonyms: | 3-Nitro-2-naphthol;2-Hydroxy-3-nitronaphthalene;3-nitronaphthalen-2-ol;2-Naphthalenol, 3-nitro- | | CAS: | 32361-60-7 | | MF: | C10H7NO3 | | MW: | 189.17 | | EINECS: | | | Product Categories: | | | Mol File: | 32361-60-7.mol |  |
| | 3-Nitro-2-naphthol Chemical Properties |
| Melting point | 103-104 °C(Solv: ethyl ether (60-29-7); ligroine (8032-32-4)) | | Boiling point | 336.7±15.0 °C(Predicted) | | density | 1.413±0.06 g/cm3(Predicted) | | pka | 6.83±0.40(Predicted) | | InChI | InChI=1S/C10H7NO3/c12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14/h1-6,12H | | InChIKey | MUELWRJOJXBHPA-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC=C2)=CC([N+]([O-])=O)=C1O |
| | 3-Nitro-2-naphthol Usage And Synthesis |
| Description | 3-Nitro-2-naphthol( also named: 2-Hydroxy-3-nitronaphthalene, 2H3NN) is a chemical compound that belongs to the naphthalene family. It is a yellow crystalline solid that is widely used in scientific research, particularly in the field of organic chemistry. 2H3NN is a versatile compound that can be synthesized using various methods, and its unique chemical properties make it useful in a wide range of applications. |
| | 3-Nitro-2-naphthol Preparation Products And Raw materials |
|