- Methoxypropiophenone
-
- $10.00 / 1ASSAYS
-
2024-04-28
- CAS:121-97-1
- Min. Order: 1ASSAYS
- Purity: 99%
- Supply Ability: 10 tons
- Methoxypropiophenone
-
- $5.00 / 25kg
-
2024-04-28
- CAS:121-97-1
- Min. Order: 1kg
- Purity: ≥98%
- Supply Ability: 200mt/year
- Methoxypropiophenone
-
- $0.00 / 1kg
-
2024-04-12
- CAS:121-97-1
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10T
|
| | Methoxypropiophenone Basic information |
| | Methoxypropiophenone Chemical Properties |
| Melting point | 27-29 °C(lit.) | | Boiling point | 273-275 °C(lit.) | | density | 0.937 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5465(lit.) | | Fp | 142 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Liquid | | Specific Gravity | 0.937 | | color | Clear colorless to amber | | Odor | at 1.00 % in dipropylene glycol. musty anisic | | Odor Type | musty | | BRN | 907733 | | InChI | InChI=1S/C10H12O2/c1-3-10(11)8-4-6-9(12-2)7-5-8/h4-7H,3H2,1-2H3 | | InChIKey | ZJVAWPKTWVFKHG-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(OC)C=C1)(=O)CC | | LogP | 2.359 (est) | | CAS DataBase Reference | 121-97-1(CAS DataBase Reference) | | NIST Chemistry Reference | 1-Propanone, 1-(4-methoxyphenyl)-(121-97-1) | | EPA Substance Registry System | 1-Propanone, 1-(4-methoxyphenyl)- (121-97-1) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | RIDADR | 1993 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | Yes | | HazardClass | 4.1 | | PackingGroup | III | | HS Code | 29145090 |
| | Methoxypropiophenone Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS TO AMBER LIQUID | | Uses | 4''-Methoxypropiophenone is a compound useful in organic synthesis. | | Definition | ChEBI: P-Methoxypropiophenone is an aromatic ketone. | | Preparation | Preparation by reaction of ethylmagnesium bromide with p-methoxybenzonitrile (95%). |
| | Methoxypropiophenone Preparation Products And Raw materials |
|