|
|
| | 3-(chloromethyl)-1-methyl-1H-1,2,4-Triazole hydrochloride Basic information |
| Product Name: | 3-(chloromethyl)-1-methyl-1H-1,2,4-Triazole hydrochloride | | Synonyms: | 3-(Chloromethyl)-1-methyl-1H-1,2,4-triazole hydrochloride;3-Chloromethyl-1-methyl-1H-[1,2,4]triazole HCl;l)-1-methyl-1H-1,2,4-triazo;3-(Gymethyl)-1-methyl-11-1,2.4-triazole hydrochloride;1H-1,2,4-Triazole, 3-(chloromethyl)-1-methyl-, hydrochloride | | CAS: | 135206-76-7 | | MF: | C4H6ClN3 | | MW: | 131.56 | | EINECS: | | | Product Categories: | S-217622 | | Mol File: | 135206-76-7.mol |  |
| | 3-(chloromethyl)-1-methyl-1H-1,2,4-Triazole hydrochloride Chemical Properties |
| Melting point | >149°C (dec.) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C4H6ClN3.ClH/c1-8-3-6-4(2-5)7-8;/h3H,2H2,1H3;1H | | InChIKey | KISIDCUHOLGEPR-UHFFFAOYSA-N | | SMILES | Cl.C(C1N=CN(C)N=1)Cl |
| HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 3-(chloromethyl)-1-methyl-1H-1,2,4-Triazole hydrochloride Usage And Synthesis |
| Uses | 3-(chloromethyl)-1-methyl-1H-1,2,4-triazole hydrochloride is a useful research chemical. |
| | 3-(chloromethyl)-1-methyl-1H-1,2,4-Triazole hydrochloride Preparation Products And Raw materials |
|