|
|
| | 4-Nitro-2-picoline N-oxide Basic information |
| | 4-Nitro-2-picoline N-oxide Chemical Properties |
| Melting point | 155-159 °C(lit.) | | Boiling point | 277.46°C (rough estimate) | | density | 1.4564 (rough estimate) | | refractive index | 1.5100 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO, Methanol | | form | powder | | pka | -1.18±0.10(Predicted) | | color | yellow to light orange | | λmax | 333nm(EtOH)(lit.) | | BRN | 135501 | | InChI | InChI=1S/C6H6N2O3/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3 | | InChIKey | FTTIAVRPJGCXAC-UHFFFAOYSA-N | | SMILES | C1(C)[N+]([O-])=CC=C([N+]([O-])=O)C=1 | | CAS DataBase Reference | 5470-66-6(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Nitro-2-picoline-n-oxide(5470-66-6) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38-40 | | Safety Statements | 22-26-36 | | RIDADR | 2811 | | WGK Germany | 3 | | RTECS | UT5710000 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29333990 |
| | 4-Nitro-2-picoline N-oxide Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | A nitroheterocyclic compound and its potential suitability as radiosensitizer for cancer radiotherapy. | | Reactivity Profile | 4-Nitro-2-picoline N-oxide could be used to synthesize 2-Methyl-4-nitro-6-(pyridin-2-yl)pyridine 1-oxide which is a key
intermediate of Caerulomycin E and A[1].
| | References | [1] Zhang, Fang , and X. F. Duan . "Facile one-pot direct arylation and alkylation of nitropyridine N-oxides with Grignard reagents. " Organic Letters 43.13(2012). |
| | 4-Nitro-2-picoline N-oxide Preparation Products And Raw materials |
|