|
|
| | propoxate Basic information |
| Product Name: | propoxate | | Synonyms: | propoxate;propyl 3-(1-phenylethyl)imidazole-4-carboxylate;1H-Imidazole-5-carboxylic acid, 1-(1-phenylethyl)-, propyl ester;Propafenate;Propyl 1-(1-Phenylethyl)-1H-imidazole-5-carboxylate | | CAS: | 7036-58-0 | | MF: | C15H18N2O2 | | MW: | 258.32 | | EINECS: | 2303166 | | Product Categories: | | | Mol File: | 7036-58-0.mol |  |
| | propoxate Chemical Properties |
| Boiling point | 403.8±20.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | pka | 4.08±0.23(Predicted) | | InChI | InChI=1S/C15H18N2O2/c1-3-9-19-15(18)14-10-16-11-17(14)12(2)13-7-5-4-6-8-13/h4-8,10-12H,3,9H2,1-2H3 | | InChIKey | LKGPZAQFNYKISK-UHFFFAOYSA-N | | SMILES | C1N(C(C2=CC=CC=C2)C)C(C(OCCC)=O)=CN=1 |
| | propoxate Usage And Synthesis |
| | propoxate Preparation Products And Raw materials |
|