- Fmoc-Ser(Ac)-OH
-
- $0.00 / 1kg
-
2024-04-30
- CAS:171778-17-9
- Min. Order: 1kg
- Purity: 99+
- Supply Ability: 1T
|
| | FMOC-SER(AC)-OH Basic information |
| Product Name: | FMOC-SER(AC)-OH | | Synonyms: | N-ALPHA-FMOC-O-ACETYL-L-SERINE;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-O-ACETYL-L-SERINE;FMOC-O-ACETYL-L-SERINE;FMOC-SERINE(AC)-OH;FMOC-SER(AC)-OH;O-Acetyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-serine;Fmoc-O-acetyl-L-serine99%;(9H-Fluoren-9-yl)MethOxy]Carbonyl Ser(Ac)-OH | | CAS: | 171778-17-9 | | MF: | C20H19NO6 | | MW: | 369.37 | | EINECS: | | | Product Categories: | | | Mol File: | 171778-17-9.mol |  |
| | FMOC-SER(AC)-OH Chemical Properties |
| Boiling point | 611.2±55.0 °C(Predicted) | | density | 1.322 | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.27±0.10(Predicted) | | InChI | InChI=1S/C20H19NO6/c1-12(22)26-11-18(19(23)24)21-20(25)27-10-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,17-18H,10-11H2,1H3,(H,21,25)(H,23,24)/t18-/m0/s1 | | InChIKey | HSGIKRPBGCJRDB-SFHVURJKSA-N | | SMILES | C(O)(=O)[C@H](COC(C)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| | FMOC-SER(AC)-OH Usage And Synthesis |
| Uses | Fmoc-Ser(Ac)-OH (Fmoc-O-acetyl-L-serine) is a Serine derivative. Fmoc-Ser(Ac)-OH can be used for the preparation of broad-spectrum coronavirus membrane fusion inhibitor[1]. |
| | FMOC-SER(AC)-OH Preparation Products And Raw materials |
|