|
|
| | 5-Bromo-2,3-dihydro-1H-inden-1-ol Basic information |
| Product Name: | 5-Bromo-2,3-dihydro-1H-inden-1-ol | | Synonyms: | BUTTPARK 91\15-77;5-BROMO-1-INDANOL;5-BROMOINDAN-1-OL;5-broMo-2,3-dihydro-1H-inden-1-ol;1H-Inden-1-ol, 5-bromo-2,3-dihydro-;5-Bromoindane-1-ol | | CAS: | 34598-50-0 | | MF: | C9H9BrO | | MW: | 213.07 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 34598-50-0.mol |  |
| | 5-Bromo-2,3-dihydro-1H-inden-1-ol Chemical Properties |
| Melting point | 77-79 °C(Solv: hexane (110-54-3)) | | Boiling point | 307.7±37.0 °C(Predicted) | | density | 1.617±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 14.05±0.20(Predicted) | | InChI | InChI=1S/C9H9BrO/c10-7-2-3-8-6(5-7)1-4-9(8)11/h2-3,5,9,11H,1,4H2 | | InChIKey | DRXIUUZVRAOHBS-UHFFFAOYSA-N | | SMILES | C1(O)C2=C(C=C(Br)C=C2)CC1 |
| | 5-Bromo-2,3-dihydro-1H-inden-1-ol Usage And Synthesis |
| Synthesis | A mixture of 5-bromo-2, 3-dihydroinden-1-one, and NaBH4 in EtOH was stirred at 60° C for 6 minutes. After evaporation of the solvent, the residue was purified by chromatography (silica gel; 1:2 EtOAc/hexane), providing compound 47.2 in 100% yield.
 |
| | 5-Bromo-2,3-dihydro-1H-inden-1-ol Preparation Products And Raw materials |
|