|
|
| | Cytidine-5'-diphosphate disodium salt Basic information |
| Product Name: | Cytidine-5'-diphosphate disodium salt | | Synonyms: | CYTIDINE-5'-DIPHOSPHATE DISODIUM SALT HEMIHYDRATE;cytidine-5'-diphosphatedisodiumsalthemihydratecrystalline;Cytidine-5'-diphosphate disodium salt;5'-CDPNa2;SodiuM 4-aMino-1-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxyMethyl)tetrahydrofuran-2-yl)-2-oxo-1,2-dihydropyriMidin-5-yl hydrogendiphosphate;Sodium 4-amino-1-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-2-oxo-1,2-di;Cytidine 5'-(trihydrogen diphosphate),disodiuM salt;Cytidine-5'-diphosphated | | CAS: | 54394-90-0 | | MF: | C9H16N3NaO11P2 | | MW: | 427.17 | | EINECS: | 2017-001-1 | | Product Categories: | Material;Pharmaceutical | | Mol File: | 54394-90-0.mol |  |
| | Cytidine-5'-diphosphate disodium salt Chemical Properties |
| form | Powder | | color | White to Off-white | | InChIKey | MAGSIBHRUIBONY-RFFBCSJBNA-N | | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=CC(N)=NC1=O)O.[NaH] |&1:1,2,3,15,r| |
| | Cytidine-5'-diphosphate disodium salt Usage And Synthesis |
| | Cytidine-5'-diphosphate disodium salt Preparation Products And Raw materials |
|