|
|
| | 4-(4-Aminophenyl)butyric acid Basic information |
| | 4-(4-Aminophenyl)butyric acid Chemical Properties |
| Melting point | 121-124 °C (lit.)
121-133 °C | | Boiling point | 363.7±17.0 °C(Predicted) | | density | 1.177±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.70±0.10(Predicted) | | color | Light Beige to Light Brown | | InChI | InChI=1S/C10H13NO2/c11-9-6-4-8(5-7-9)2-1-3-10(12)13/h4-7H,1-3,11H2,(H,12,13) | | InChIKey | RBHLFWNKEWLHBP-UHFFFAOYSA-N | | SMILES | C1(CCCC(O)=O)=CC=C(N)C=C1 | | CAS DataBase Reference | 15118-60-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2922498590 |
| | 4-(4-Aminophenyl)butyric acid Usage And Synthesis |
| Description | 4-(4-Aminophenyl)butyric acid (4-APB) is an important organic compound derived from butyric acid, which is used as a synthetic intermediate for pharmaceuticals or the synthesis of various compounds. It is also used in drug mechanism studies and is thought to be an agonist for certain G-protein coupled receptors and may also interact with other proteins in the signal transduction pathway. In addition, 4-(4-aminophenyl)butyric acid has been found to inhibit monoamine oxidase, which plays a role in neurotransmitter catabolism. | | Uses | 4-(4-Aminophenyl)butyric Acid is a degradation product of Chlorambucil (C325050); an alkylating agent that is used as an chemotherapy drug in the treatment of chronic lymphocytic leukemia. Chlorambucil is also used to treat non-Hodgkin''s lymphoma (NHL) and Hodgkin''s disease. |
| | 4-(4-Aminophenyl)butyric acid Preparation Products And Raw materials |
|