| Identification | Back Directory | [Name]
2,2-DIMETHYLTETRAHYDROFURAN | [CAS]
1003-17-4 | [Synonyms]
2,2-dimethyloxolane 2,2-DIMETHYLTETRAHYDROFURAN 2,2-Dimethyltetrahydrofurane Tetrahydrofuran, 2,2-dimethyl- Furan, tetrahydro-2,2-dimethyl- | [Molecular Formula]
C6H12O | [MDL Number]
MFCD00060904 | [MOL File]
1003-17-4.mol | [Molecular Weight]
100.16 |
| Chemical Properties | Back Directory | [Melting point ]
-114.46°C | [Boiling point ]
92°C | [density ]
0.8355 (estimate) | [refractive index ]
1.4070 | [InChI]
InChI=1S/C6H12O/c1-6(2)4-3-5-7-6/h3-5H2,1-2H3 | [InChIKey]
ZPDIRKNRUWXYLJ-UHFFFAOYSA-N | [SMILES]
O1CCCC1(C)C |
| Hazard Information | Back Directory | [Uses]
2,2-Dimethyltetrahydrofuran is a heterocyclic ether used in the synthesis of tetrahydrofuran and other tetrahydropyran derivatives. |
|
| Company Name: |
nanjingxinxushengwu Gold
|
| Tel: |
18551665066 13338143259 |
| Website: |
www.chemicalbook.com/supplier/25618340/ |
|