| Identification | Back Directory | [Name]
FMOC-SER(TBU)-OPFP | [CAS]
105751-13-1 | [Synonyms]
-OPfp Fmoc-Ser(tBu)-OPf FMOC-SER(TBU)-OPFP FMOC-L-SER(TBU)-OPFP FMOC-SERINE(TBU)-OPFP FMOC-SER(TBU)-OPFP 5 G FMOC-SER(TBU)-OPFPFMOC-SER FMOC-O-T-BUTYL-L-SERINE PENTAFLUOROPHENYL ESTER FMOC-O-TERT-BUTYL-L-SERINE PENTAFLUOROPHENYL ESTER (9H-Fluoren-9-yl)MethOxy]Carbonyl Ser(tBu)-Opfp (Syrup) N-alpha-FMoc-O-t-butyl-L-serine pentafluorophenyl ester N-Fmoc-O-tert-butyl-L-serine pentafluorophenyl ester, 90% FMOC-O-TERT-BUTYL-L-SERINE PENTAFLUORO-PHENYL ESTER, TECHN 90+% (HPLC) N-9-Fluorenylmethoxycarbonyl-O-tert-butylserine pentafluorophenyl ester N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-O-T-BUTYL-L-SERINE PENTAFLUORPHENOL ESTER (S)-perfluorophenyl 2-(((9H-fluoren-9-yl)methoxy)carbonylamino)-3-tert-butoxypropanoate L-Serine,O-(1,1-dimethylethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-,2,3,4,5,6-pentafluorophenyl ester 2,3,4,5,6-pentafluorophenyl (2S)-3-(tert-butoxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoate | [Molecular Formula]
C28H24F5NO5 | [MDL Number]
MFCD00062213 | [MOL File]
105751-13-1.mol | [Molecular Weight]
549.49 |
| Chemical Properties | Back Directory | [Melting point ]
67-71℃ | [Boiling point ]
628.2±55.0 °C(Predicted) | [density ]
1.349±0.06 g/cm3(Predicted) | [storage temp. ]
Store at -15°C to -25°C. | [solubility ]
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | [form ]
Powder | [pka]
9.82±0.46(Predicted) | [Appearance]
brown oil | [Major Application]
peptide synthesis | [InChIKey]
DOUJYVMLNKRFHE-IBGZPJMESA-N | [SMILES]
Fc1c(c(c(c(c1F)F)OC(=O)[C@@H](NC(=O)OCC2c3c(cccc3)c4c2cccc4)COC(C)(C)C)F)F |
| Hazard Information | Back Directory | [Uses]
Fmoc-Ser(tBu)-OPfp is used as a reactant in the synthesis of peptides and peptide derivatives. | [reaction suitability]
reaction type: Fmoc solid-phase peptide synthesis |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Shanghai GL Peptide Ltd.
|
| Telephone: |
+86-21-61263310 13764994101 |
| Website: |
www.chemicalbook.com/supplier/10480342/ |
|