| Identification | Back Directory | [Name]
(9H-Fluoren-9-yl)MethOxy]Carbonyl Ser(tBu)-Gly-OH | [CAS]
81672-17-5 | [Synonyms]
Fmoc-Ser(tBu)-Gly-OH (9H-Fluoren-9-yl)MethOxy]Carbonyl Ser(tBu)-Gly-OH 2-[(2S)-3-(tert-butoxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]acetic acid | [Molecular Formula]
C24H28N2O6 | [MDL Number]
MFCD18427306 | [MOL File]
81672-17-5.mol | [Molecular Weight]
440.49 |
| Chemical Properties | Back Directory | [Boiling point ]
703.1±60.0 °C(Predicted) | [density ]
1.243±0.06 g/cm3(Predicted) | [pka]
3.29±0.10(Predicted) | [InChIKey]
KXWFIADQSGXDHH-FQEVSTJZSA-N | [SMILES]
C(O)(=O)CNC(=O)[C@H](COC(C)(C)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| Hazard Information | Back Directory | [Definition]
Fmoc-Ser(tBu)-Gly-OH serves as a building block in the synthesis of peptides. The Fmoc group acts as a protective group, allowing for selective deprotection and subsequent coupling reactions during solid-phase peptide synthesis. Fmoc is often preferred over Boc because of its ease of cleavage. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
Shanghai GL Peptide Ltd.
|
| Tel: |
+86-21-61263340; 17609490614 13764994101 |
| Website: |
https://www.chemicalbook.com/supplier/10480342/ |
|