| Identification | Back Directory | [Name]
CLEMASTANIN B | [CAS]
112747-98-5 | [Synonyms]
CLEMASTANIN B Lariciresinol 4,4'-bis-O-beta-D-glucopyranoside β-D-Glucopyranoside, 4-[(2S,3R,4R)-4-[[4-(β-D-glucopyranosyloxy)-3-methoxyphenyl]methyl]tetrahydro-3-(hydroxymethyl)-2-furanyl]-2-methoxyphenyl | [Molecular Formula]
C32H44O16 | [MDL Number]
MFCD10566604 | [MOL File]
112747-98-5.mol | [Molecular Weight]
684.68 |
| Chemical Properties | Back Directory | [density ]
1.478±0.06 g/cm3 (20 ºC 760 Torr) | [storage temp. ]
-20°C | [solubility ]
water: slightly soluble | [form ]
Solid | [color ]
White to off-white | [biological source]
plant | [Water Solubility ]
water: slightly soluble | [Major Application]
metabolomics vitamins, nutraceuticals, and natural products | [InChIKey]
PBLWZMSRSJTRHJ-NCIRKIHRSA-N | [SMILES]
O1[C@@H]([C@H]([C@H](C1)Cc4cc(c(cc4)O[C@@H]5O[C@@H]([C@H]([C@@H]([C@H]5O)O)O)CO)OC)CO)c2cc(c(cc2)O[C@@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O)CO)OC |
| Hazard Information | Back Directory | [Uses]
Clemastanin B displays some inhibition to HSV virus. Also, it is found to inhibit different subtypes of human (H1N1, including swine-origin H1N1; H3N2 and influenza B) and avian influenza viruses (H6N2, H7N3, H9N2) at different magnitudes. | [Biological Activity]
Clemastanin B has antioxidant and anti-inflammatory activitiesit exerts its anti-influenza activity by inhibiting the virus multiplicationprophylaxsis and blocking the virus attachment. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
cjbscvictory
|
| Tel: |
13348960310 |
| Website: |
https://www.weikeqi-biotech.com/ |
|