| Identification | Back Directory | [Name]
6,9,12,15-octadecatetraenoic acid | [CAS]
119798-44-6 | [Synonyms]
ethyl stearidonate 6,9,12,15-octadecatetraenoic acid (6Z,9Z,12Z,15Z)-ethyl octadeca-6,9,12,15-tetraenoate (6Z,9Z,12Z,15Z)-6,9,12,15-Octadecatetraenoic Acid Ethyl Ester 6,9,12,15-Octadecatetraenoic acid, ethyl ester, (6Z,9Z,12Z,15Z)- (all-Z)- 6,9,12,15-Octadecatetraenoic Acid Ethyl Ester Ethyl Stearidonate | [Molecular Formula]
C20H32O2 | [MDL Number]
MFCD01711183 | [MOL File]
119798-44-6.mol | [Molecular Weight]
304.47 |
| Chemical Properties | Back Directory | [Boiling point ]
389.4±31.0 °C(Predicted) | [density ]
0.904±0.06 g/cm3(Predicted) | [solubility ]
DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; Ethanol:PBS (pH7.2)(1:2): .25 mg/ml | [InChI]
InChI=1S/C20H32O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h5-6,8-9,11-12,14-15H,3-4,7,10,13,16-19H2,1-2H3/b6-5-,9-8-,12-11-,15-14- | [InChIKey]
RIDOSNBWMUADGT-AFSLFLIVSA-N | [SMILES]
C(OCC)(=O)CCCC/C=C\C/C=C\C/C=C\C/C=C\CC |
| Hazard Information | Back Directory | [Uses]
6,9,12,15-octadecatetraenoic acid is a fatty acid ester as cholecystokinin receptor, used for preventing and treating gastric disorders.
| [Uses]
A fatty acid ester as cholecystokinin receptor, used for preventing and treating gastric disorders. | [Definition]
6,9,12,15-octadecatetraenoic acid is a long-chain fatty acid ethyl ester resulting from the formal condensation of the carboxy group of stearidonic acid with the hydroxy group of ethanol.
|
|
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
TOSUN PHARM
|
| Tel: |
020-61855200 13326451905 |
| Website: |
www.toref.cn/ |
|