| Identification | Back Directory | [Name]
3-Bromo-5-methylpyridine-2-carboxylic acid | [CAS]
1211515-68-2 | [Synonyms]
3-Bromo-5-methylpicolinicaci
3-BroMo-5-Methylpicolinic acid
3-broMo-5-Methylpyridin-2-carboxylic acid
3-Bromo-5-methylpyridine-2-carboxylic acid
3-bromo-5-methyl-2-pyridinecarboxylic acid
2-Pyridinecarboxylic acid, 3-bromo-5-methyl-
3-Bromo-5-methylpyridine-2-carboxylic acid 97%
3-Bromo-5-methylpicolinic acid, 3-Bromo-2-carboxy-5-methylpyridine | [Molecular Formula]
C7H6BrNO2 | [MDL Number]
MFCD17214206 | [MOL File]
1211515-68-2.mol | [Molecular Weight]
216.03 |
| Chemical Properties | Back Directory | [storage temp. ]
under inert gas (nitrogen or Argon) at 2-8°C | [form ]
solid | [color ]
White | [InChI]
InChI=1S/C7H6BrNO2/c1-4-2-5(8)6(7(10)11)9-3-4/h2-3H,1H3,(H,10,11) | [InChIKey]
BAFGEDISONEYIX-UHFFFAOYSA-N | [SMILES]
C1(C(O)=O)=NC=C(C)C=C1Br |
| Hazard Information | Back Directory | [Description]
3-Bromo-5-methylpyridine-2-carboxylic acid is an organic compound with the molecular formula C7H6BrNO2. It is a derivative of pyridine, a primary heterocyclic organic compound. This compound is characterized by a bromine atom at the third position, a methyl group at the fifth position, and a carboxylic acid group at the second position of the pyridine ring. 3-Bromo-5-methylpyridine-2-carboxylic acid can be synthesized through several methods. One common method involves the bromination of 5-methylpyridine-2-carboxylic acid using a brominating agent such as N-bromosuccinimide (NBS) in the presence of a catalyst like azobisisobutyronitrile (AIBN). The reaction typically occurs in an organic solvent such as dichloromethane at a controlled temperature.
|
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Telephone: |
18210857532 18210857532 |
| Website: |
https://www.jkchemical.com |
| Company Name: |
Cool Pharm, Ltd
|
| Telephone: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
|