| Identification | Back Directory | [Name]
L-Arginine-13C6,15N4 Na-Fmoc-Nw-Pbf derivative | [CAS]
1217461-89-6 | [Synonyms]
Fmoc-Arg(Pbf)-OH-13C6,15N4
L-Arginine-13C6,15N4-N-FMOC, PBF-OH
Fmoc-Arg(Pbf)-OH-13C6,15N4
L-Arginine-13C6,15N4 Na-Fmoc-Nw-Pbf derivative | [Molecular Formula]
C34H40N4O7S | [MDL Number]
MFCD08702962 | [MOL File]
1217461-89-6.mol | [Molecular Weight]
658.859 |
| Chemical Properties | Back Directory | [storage temp. ]
2-8°C | [form ]
solid | [Major Application]
peptide synthesis | [InChIKey]
HNICLNKVURBTKV-NJBLHHMJSA-N | [SMILES]
Cc1c(C)c(c(C)c2CC(C)(C)Oc12)S(=O)(=O)[15NH][13C](=[15NH])[15NH][13CH2][13CH2][13CH2][13C@H]([15NH]C(=O)OCC3c4ccccc4-c5ccccc35)[13C](O)=O | [CAS Number Unlabeled]
154445-77-9 |
| Hazard Information | Back Directory | [Uses]
Fmoc-?Arg(Pbf)?-?OH (U-13C6, U-15N4) is a reagent in the preparation of mannose-binding lectin (MBL)-associated serine protease (MASP) inhibitory peptides and cyclic peptides. |
|
| Company Name: |
ChemPep, Inc.
|
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Website: |
www.chempep.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|