| Identification | Back Directory | [Name]
L-Lysine-13C6.15N2, α-N-Fmoc, ε-N-t-Boc | [CAS]
850080-89-6 | [Synonyms]
Fmoc-Lys(Boc)-OH-13C6,15N2
[U-13C6,U-15N2]-Fmoc-Lys(Boc)-OH
L-Lysine-13C6,15N2 (Boc), N-Fmoc
L-Lysine-13C6.15N2, α-N-Fmoc, ε-N-t-Boc | [Molecular Formula]
C26H32N2O6 | [MDL Number]
MFCD08702960 | [MOL File]
850080-89-6.mol | [Molecular Weight]
476.49 |
| Chemical Properties | Back Directory | [Melting point ]
130-135 °C(lit.) | [density ]
1.210±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | [storage temp. ]
2-8°C | [form ]
solid | [InChIKey]
UMRUUWFGLGNQLI-OYSAUITLSA-N | [SMILES]
C(C1C2=CC=CC=C2C2=CC=CC=C12)OC(=O)[15NH][13C@H]([13C](=O)O)[13CH2][13CH2][13CH2][13CH2][15NH]C(=O)OC(C)(C)C | [CAS Number Unlabeled]
71989-26-9 |
| Hazard Information | Back Directory | [Uses]
Fmoc-Lys(Boc)-OH(13C6,15N2) can be used to prepare peptide-based probes containing hydroaxamate amino acids for substrate selectivity and components of endogenous mammalian histone deacetylase complex. This compound can be used for assays for insulin-degrading enzyme inhibitors using IDE-binding probes for treating various diseases. |
|
| Company Name: |
ChemPep, Inc.
|
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Website: |
www.chempep.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|